Ligand name: Fingolimod
PDB ligand accession: n/a
DrugBank: DB08868
InChI Key:
SMILES: CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1

List of proteins that are targets for DB08868

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	Q99500_DB08868	Q99500	Sphingosine 1-phosphate receptor	modulator	IC50(nM) = 10000.0 EC50(nM) = 3.0
2	P21453_DB08868	P21453	Sphingosine 1-phosphate receptor	modulator	IC50(nM) = 604.0 EC50(nM) = 0.3
3	O95977_DB08868	O95977	Sphingosine 1-phosphate receptor	modulator	IC50(nM) = 10000.0 EC50(nM) = 0.3
4	Q9H228_DB08868	Q9H228	Sphingosine 1-phosphate receptor	modulator	IC50(nM) = 2100.0 EC50(nM) = 0.3
5	Q13547_DB08868	Q13547	Histone deacetylase 1	inhibitor