Ligand name: Pomalidomide
PDB ligand accession: n/a
DrugBank: DB08910
InChI Key:
SMILES: NC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O

List of proteins that are targets for DB08910

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P01375_DB08910	P01375	Tumor necrosis factor	inhibitor	IC50(nM) = 33.0
2	P35354_DB08910	P35354	Prostaglandin G/H synthase	inhibitor
3	Q96SW2_DB08910	Q96SW2	Protein cereblon	inhibitor	Ki(nM) = 3300.0 IC50(nM) = 83.0 Kd(nM) = 1000.0