Ligand name: Ifenprodil
PDB ligand accession: n/a
DrugBank: DB08954
InChI Key:
SMILES: CC(C(O)C1=CC=C(O)C=C1)N1CCC(CC2=CC=CC=C2)CC1

List of proteins that are targets for DB08954

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	Q13224_DB08954	Q13224	Glutamate receptor ionotropic,	antagonist	Ki(nM) = 5.8 IC50(nM) = 110.0
2	P48544_DB08954	P48544	G protein-activated inward	antagonist
3	P48051_DB08954	P48051	G protein-activated inward	antagonist
4	P48549_DB08954	P48549	G protein-activated inward	antagonist
5	Q05586_DB08954	Q05586	Glutamate receptor ionotropic,	antagonist	Ki(nM) = 10.0 IC50(nM) = 66.0