PDB ligand accession: LEV
DrugBank: DB09078
PubChem:
ChEMBL:
InChI Key: WOSKHXYHFSIKNG-UHFFFAOYSA-N
SMILES: COc1cc2c(cc1C(=O)N)c(ccn2)Oc3ccc(c(c3)Cl)NC(=O)NC4CC4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Quinolines and derivatives
- Subclass: Quinoline carboxamides
- Class: Quinolines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P35916_LEV | P35916 | Vascular endothelial growth | inhibitor | |
2 | P22607_LEV | P22607 | Fibroblast growth factor | inhibitor | |
3 | P21802_LEV | P21802 | Fibroblast growth factor | inhibitor | |
4 | P07949_LEV | P07949 | Proto-oncogene tyrosine-protein kinase | inhibitor | |
5 | P22455_LEV | P22455 | Fibroblast growth factor | inhibitor | |
6 | P35968_LEV | P35968 | Vascular endothelial growth | inhibitor | |
7 | P11362_LEV | P11362 | Fibroblast growth factor | inhibitor | |
8 | P16234_LEV | P16234 | Platelet-derived growth factor | inhibitor | |
9 | P10721_LEV | P10721 | Mast/stem cell growth | inhibitor | |
10 | P17948_LEV | P17948 | Vascular endothelial growth | inhibitor |