PDB ligand accession: 34W
DrugBank: DB13059
PubChem:
ChEMBL:
InChI Key: RYYNGWLOYLRZLK-RBUKOAKNSA-N
SMILES: CC(=O)NCC(=O)N1C2CCC1c3c2ccc(c3)Nc4ncc(c(n4)NC5CCC5)C(F)(F)F
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P30291_34W | P30291 | Wee1-like protein kinase | n/a | |
| 2 | Q9Y6E0_34W | Q9Y6E0 | Serine/threonine-protein kinase 24 | n/a | |
| 3 | O75385_34W | O75385 | Serine/threonine-protein kinase ULK1 | n/a |