PDB ligand accession: MQ7
DrugBank: DB13075
PubChem:
ChEMBL:
InChI Key: RAKQPZMEYJZGPI-LJWNYQGCSA-N
SMILES: CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Sesquaterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q8GJ31_MQ7 | Q8GJ31 | Tetrachloroethene reductive dehalogenase | n/a | |
2 | P0A8Q0_MQ7 | P0A8Q0 | Fumarate reductase subunit | n/a | |
3 | C5A1E7_MQ7 | C5A1E7 | deleted | n/a | |
4 | A0A063X8D0_MQ7 | A0A063X8D0 | Quinol oxidase subunit | n/a | |
5 | Q72LA6_MQ7 | Q72LA6 | Hypothetical membrane spanning | n/a | |
6 | P06010_MQ7 | P06010 | Reaction center protein | n/a | |
7 | T2GAT5_MQ7 | T2GAT5 | Putative Fumarate reductase | n/a | |
8 | C9QU46_MQ7 | C9QU46 | deleted | n/a | |
9 | P07173_MQ7 | P07173 | Photosynthetic reaction center | n/a | |
10 | P0A8Q3_MQ7 | P0A8Q3 | Fumarate reductase subunit | n/a | |
11 | Q72LA5_MQ7 | Q72LA5 | NrfC protein | n/a | |
12 | P06009_MQ7 | P06009 | Reaction center protein | n/a | |
13 | P0AC47_MQ7 | P0AC47 | Fumarate reductase iron-sulfur | n/a | |
14 | P06008_MQ7 | P06008 | Reaction center protein | n/a | |
15 | R4P168_MQ7 | R4P168 | deleted | n/a |