PDB ligand accession: 046
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: VQLNKQZLPGLOSI-UHFFFAOYSA-N
SMILES: CC(=O)Nc1cc(ncn1)Oc2ccc3c(c2)CCN3C(=O)Nc4ccc(c(c4)C(F)(F)F)CN5CCN(CC5)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolecarboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | E9BA99_046 | E9BA99 | Mitogen-activated protein kinase | n/a | |
| 2 | O60674_046 | O60674 | Tyrosine-protein kinase JAK2 | n/a |