PDB ligand accession: 04C
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: SLVOSRJOLWNALP-QAKIEGLASA-N
SMILES: CC(CO)C(C(Cc1ccccc1)NC(=O)C(Cc2ccc(cc2)OC)NC(=O)C(C)NC(=O)CN3CCOCC3)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P70195_04C | P70195 | Proteasome subunit beta | n/a | |
2 | P28063_04C | P28063 | Proteasome subunit beta | n/a | |
3 | P28062_04C | P28062 | Proteasome subunit beta | n/a | |
4 | P23724_04C | P23724 | Proteasome subunit beta | n/a | |
5 | O55234_04C | O55234 | Proteasome subunit beta | n/a | |
6 | P28074_04C | P28074 | Proteasome subunit beta | n/a | |
7 | O09061_04C | O09061 | Proteasome subunit beta | n/a | |
8 | P30656_04C | P30656 | Proteasome subunit beta | n/a | |
9 | P25043_04C | P25043 | Proteasome subunit beta | n/a | |
10 | P25451_04C | P25451 | Proteasome subunit beta | n/a | |
11 | P38624_04C | P38624 | Proteasome subunit beta | n/a | |
12 | Q9R1P1_04C | Q9R1P1 | Proteasome subunit beta | n/a | |
13 | Q60692_04C | Q60692 | Proteasome subunit beta | n/a |