PDB ligand accession: 1D0
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: MKNJFLJOSVXALN-XMHGGMMESA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CN=C(CNc2ccccc2O)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxamines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A5K1VAP1_1D0 | A0A5K1VAP1 | Tryptophan synthase beta | n/a | |
2 | P0A2K1_1D0 | P0A2K1 | Tryptophan synthase beta | n/a | |
3 | A0A0J0ZFZ1_1D0 | A0A0J0ZFZ1 | Tryptophan synthase beta | n/a |