PDB ligand accession: 1FL
DrugBank: DB00861
PubChem:
ChEMBL:
InChI Key: HUPFGZXOMWLGNK-UHFFFAOYSA-N
SMILES: c1cc(c(cc1c2ccc(cc2F)F)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Biphenyls and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P35354_1FL | P35354 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 8200.0 |
| 2 | Q83V25_1FL | Q83V25 | 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase (EC | n/a | |
| 3 | P23219_1FL | P23219 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 10000.0 |
| 4 | P02766_1FL | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | Ki(nM) = 2100.0 IC50(nM) = 3500.0 Kd(nM) = 75.0 EC50(nM) = 5600.0 |
| 5 | P02768_1FL | P02768 | Albumin | n/a | Ki(nM) = 58800.0 Kd(nM) = 1230.0 |
| 6 | O25242_1FL | O25242 | Beta sliding clamp | n/a |