PDB ligand accession: 1Q7
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: FVCUZJIKIIWHJD-OAHLLOKOSA-N
SMILES: Cc1cc(nc(c1)N)COCC(CN)OCc2cc(cc(n2)N)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Aminopyridines and derivatives
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P29473_1Q7 | P29473 | Nitric oxide synthase | n/a | |
| 2 | P29476_1Q7 | P29476 | Nitric oxide synthase | n/a |