PDB ligand accession: 1SY
DrugBank: n/a
PubChem: 71563406;135564529;
ChEMBL:
InChI Key: XRILCFTWUCUKJR-INFSMZHSSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3C(C4C(O3)COP(=O)(OC5C(C(COP(=O)(O4)O)OC5n6cnc7c6NC(=NC7=O)N)O)O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B8XX90_1SY | B8XX90 | Stimulator of interferon | n/a | |
2 | Q8N884_1SY | Q8N884 | Cyclic GMP-AMP synthase | n/a | |
3 | Q3TBT3_1SY | Q3TBT3 | Stimulator of interferon | n/a | |
4 | F1M391_1SY | F1M391 | Stimulator of interferon | n/a | |
5 | Q8C6L5_1SY | Q8C6L5 | Cyclic GMP-AMP synthase | n/a | |
6 | A0A2B4SJD2_1SY | A0A2B4SJD2 | Stimulator of interferon | n/a | |
7 | P41440_1SY | P41440 | Reduced folate transporter | n/a | |
8 | A0A1D5P7Q9_1SY | A0A1D5P7Q9 | Stimulator of interferon | n/a | |
9 | P0DUE1_1SY | P0DUE1 | Stimulator of interferon | n/a | |
10 | A7SLZ2_1SY | A7SLZ2 | Stimulator of interferon | n/a | |
11 | Q86WV6_1SY | Q86WV6 | Stimulator of interferon | n/a |