PDB ligand accession: 21V
DrugBank: DB04322
PubChem: 445072;5288680;135409836;
ChEMBL: n/a
InChI Key: ZUQBAQVRAURMCL-WFASDCNBSA-N
SMILES: c1cc(ccc1CCC2CC3=C(NC2)NC(=NC3=O)N)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P11586_21V | P11586 | C-1-tetrahydrofolate synthase, cytoplasmic | n/a | |
| 2 | P00374_21V | P00374 | Dihydrofolate reductase (EC | n/a |