PDB ligand accession: 31A
DrugBank: n/a
PubChem: 117072424;137348114;
ChEMBL: n/a
InChI Key: WTWXRFGIIFJWMN-UHFFFAOYSA-N
SMILES: COc1cccc(c1)CC(=N)NC(=O)c2ccccc2OC3CCNCC3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A5K1A2_31A | A5K1A2 | Glycylpeptide N-tetradecanoyltransferase (EC | n/a | |
2 | Q4Q5S8_31A | Q4Q5S8 | Glycylpeptide N-tetradecanoyltransferase (EC | n/a | |
3 | P30419_31A | P30419 | Glycylpeptide N-tetradecanoyltransferase 1 | n/a |