Ligand name: 8-[(3R)-3-Aminopiperidin-1-yl]-7-but-2-yn-1-yl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-3,7-dihydro-1H-purine-2,6-d ione
PDB ligand accession: 356
DrugBank: DB08882
PubChem: 10096344
ChEMBL: CHEMBL237500
InChI Key: LTXREWYXXSTFRX-QGZVFWFLSA-N
SMILES: CC#CCn1c2c(nc1N3CCCC(C3)N)N(C(=O)N(C2=O)Cc4nc(c5ccccc5n4)C)C

ClassyFire chemical classification:

List of proteins that are targets for 356

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q12884_356 Q12884 Prolyl endopeptidase FAP n/a IC50(nM) = 89.0
2 P27487_356 P27487 Dipeptidyl peptidase 4 inhibitor IC50(nM) = 0.1
Kd(nM) = 0.0066
EC50(nM) = 3.1