PDB ligand accession: 3TL
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: BJJPNOGMLLUCER-KUTQPOQPSA-N
SMILES: CC(C)C(C(=O)NC(Cc1ccccc1)C(C(C(Cc2ccccc2)NC(=O)C(C(C)C)NC(=O)C(C)NC(=O)OCc3ccccc3)O)O)NC(=O)C(C)NC(=O)OCc4ccccc4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P03367_3TL | P03367 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
2 | Q903N5_3TL | Q903N5 | Protease | n/a | |
3 | P03366_3TL | P03366 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
4 | P16088_3TL | P16088 | Pol polyprotein [Cleaved | n/a | |
5 | Q9E7M1_3TL | Q9E7M1 | Gag-Pol polyprotein | n/a | |
6 | Q6Q004_3TL | Q6Q004 | Protease | n/a | |
7 | Q8Q8V9_3TL | Q8Q8V9 | Protease | n/a | |
8 | Q7SRY5_3TL | Q7SRY5 | Protease | n/a | |
9 | Q90EA1_3TL | Q90EA1 | Protease | n/a | |
10 | Q6BB74_3TL | Q6BB74 | Pol protein | n/a | |
11 | P12499_3TL | P12499 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
12 | Q72863_3TL | Q72863 | Pol polyprotein | n/a |