PDB ligand accession: 478
DrugBank: DB00701
PubChem:
ChEMBL:
InChI Key: YMARZQAQMVYCKC-OEMFJLHTSA-N
SMILES: CC(C)CN(CC(C(Cc1ccccc1)NC(=O)OC2CCOC2)O)S(=O)(=O)c3ccc(cc3)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzenesulfonamides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9E7M1_478 | Q9E7M1 | Gag-Pol polyprotein | n/a | |
2 | Q7SSE3_478 | Q7SSE3 | Protease | n/a | |
3 | C8BD48_478 | C8BD48 | Protease | n/a | |
4 | P35963_478 | P35963 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
5 | Q9W9R3_478 | Q9W9R3 | Protease | n/a | |
6 | Q9J006_478 | Q9J006 | Protease | n/a | |
7 | P00791_478 | P00791 | Pepsin A (EC | n/a | |
8 | P03366_478 | P03366 | Gag-Pol polyprotein (Pr160Gag-Pol) | inhibitor | |
9 | P03369_478 | P03369 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
10 | Q7SSI0_478 | Q7SSI0 | Protease | n/a | |
11 | P03367_478 | P03367 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
12 | P04587_478 | P04587 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a |