PDB ligand accession: 4NP
DrugBank: DB04214
PubChem:
ChEMBL:
InChI Key: XZKIHKMTEMTJQX-UHFFFAOYSA-N
SMILES: c1cc(ccc1[N+](=O)[O-])OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Organic phosphoric acids and derivatives
- Subclass: Phosphate esters
- Class: Organic phosphoric acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P24666_4NP | P24666 | Low molecular weight | n/a | |
2 | Q9BVJ7_4NP | Q9BVJ7 | Dual specificity protein | n/a | |
3 | Q9NRW4_4NP | Q9NRW4 | Dual specificity protein | n/a | |
4 | Q97VZ7_4NP | Q97VZ7 | Protein phosphatase | n/a | |
5 | D3KVM3_4NP | D3KVM3 | glycerol kinase (EC | n/a | |
6 | P15693_4NP | P15693 | Intestinal-type alkaline phosphatase | n/a | |
7 | Q9YBQ2_4NP | Q9YBQ2 | Acylamino-acid-releasing enzyme (AARE) | n/a | |
8 | P40347_4NP | P40347 | Low molecular weight | n/a |