PDB ligand accession: 529
DrugBank: DB07137
PubChem: n/a
ChEMBL: n/a
InChI Key: JPAWNIKVRIVDBT-NABPABCNSA-N
SMILES: CC(c1ccc(cc1)N2CCNC2=O)C(=O)N=C3C=C(N=N3)C4CC4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylacetamides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P24941_529 | P24941 | Cyclin-dependent kinase 2 | n/a | |
| 2 | P20248_529 | P20248 | Cyclin-A2 (Cyclin-A) (Cyclin | n/a |