Ligand name: (5R)-5-(4-methoxy-3-propoxyphenyl)-5-methyl-1,3-oxazolidin-2-one
PDB ligand accession: 5RM
DrugBank: DB01647
PubChem: 449190
ChEMBL: CHEMBL603830
InChI Key: PCCPERGCFKIYIS-AWEZNQCLSA-N
SMILES: CCCOc1cc(ccc1OC)C2(CNC(=O)O2)C

ClassyFire chemical classification:

List of proteins that are targets for 5RM

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q07343_5RM Q07343 3',5'-cyclic-AMP phosphodiesterase 4B inhibitor IC50(nM) = 420.0