PDB ligand accession: 655
DrugBank: DB02526
PubChem:
ChEMBL:
InChI Key: WCFWDBPDMBXMTQ-UHFFFAOYSA-N
SMILES: c1cc(c(c(c1)OC2CCCC2)[O-])c3[nH]c4ccc(cc4n3)C(=[NH2+])N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Benzimidazoles
- Subclass: Phenylbenzimidazoles
- Class: Benzimidazoles
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P00749_655 | P00749 | Urokinase-type plasminogen activator | inhibitor | |
| 2 | P00760_655 | P00760 | Serine protease 1 | n/a | |
| 3 | P07477_655 | P07477 | Serine protease 1 | n/a |