PDB ligand accession: 7OA
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ARWGTMGGJGADTI-VFGYXJDYSA-N
SMILES: CC(C)CN(CC(C(Cc1cc(cc(c1)F)F)NC(=O)OC2C3CC4C2COC4OC3)O)S(=O)(=O)c5ccc6c(c5)sc(n6)NC7CC7
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylbutylamines
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O38885_7OA | O38885 | Protease | n/a | |
2 | C8B467_7OA | C8B467 | Protease | n/a | |
3 | O38893_7OA | O38893 | Protease | n/a | |
4 | I7AJ09_7OA | I7AJ09 | Protease | n/a | |
5 | Q5RZ08_7OA | Q5RZ08 | Protease | n/a | |
6 | Q9YUI7_7OA | Q9YUI7 | Integrase | n/a | |
7 | P03366_7OA | P03366 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a |