PDB ligand accession: 8CS
DrugBank: n/a
PubChem: 49866574;136206357;
ChEMBL: n/a
InChI Key: PWFXLXMPGSLEOZ-RNCCKPSGSA-N
SMILES: C1C2C(C(=O)C3C(O2)NC4=C(N3)C(=O)NC(=N4)N)OP(=O)(O1)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q7A441_8CS | Q7A441 | Molybdopterin synthase sulfur | n/a | |
2 | P65401_8CS | P65401 | Molybdopterin synthase catalytic | n/a | |
3 | W0KCK5_8CS | W0KCK5 | deleted | n/a |