PDB ligand accession: 8GD
DrugBank: n/a
PubChem: 49835950;135566401;
ChEMBL: n/a
InChI Key: LJMLTZSNWOCYNQ-VPENINKCSA-N
SMILES: C1C(C(OC1N2C3=C(C(=O)NC(=N3)N)NC2=O)COP(=O)(O)OP(=O)(O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine deoxyribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | A0QUZ2_8GD | A0QUZ2 | 8-oxo-(d)GTP phosphatase (8-oxo-(d)GTPase) | n/a | |
| 2 | Q9UKK9_8GD | Q9UKK9 | ADP-sugar pyrophosphatase (EC | n/a |