PDB ligand accession: 8GT
DrugBank: n/a
PubChem: 167974;5287559;135509073;
ChEMBL:
InChI Key: JCHLKIQZUXYLPW-UMMCILCDSA-N
SMILES: C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)NC2=O)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q5SH52_8GT | Q5SH52 | GTP cyclohydrolase 1 | n/a | |
2 | P30793_8GT | P30793 | GTP cyclohydrolase 1 | n/a | |
3 | A0QUZ2_8GT | A0QUZ2 | 8-oxo-(d)GTP phosphatase (8-oxo-(d)GTPase) | n/a | |
4 | P06746_8GT | P06746 | DNA polymerase beta | n/a | |
5 | Q5F9K6_8GT | Q5F9K6 | GTP cyclohydrolase FolE2 | n/a | |
6 | Q9NP87_8GT | Q9NP87 | DNA-directed DNA/RNA polymerase | n/a | |
7 | W8STT9_8GT | W8STT9 | DNA polymerase IV | n/a |