Ligand name: (2R)-2-(4-hydroxyphenyl)-2-[[(2S)-2-methyl-3-sulfanyl-propanoyl]amino]ethanoic acid
PDB ligand accession: 8PO
DrugBank: n/a
PubChem: 132274395
ChEMBL: CHEMBL4167648
InChI Key: XFVAHOYBWXJSDW-GMSGAONNSA-N
SMILES: CC(CS)C(=O)NC(c1ccc(cc1)O)C(=O)O

ClassyFire chemical classification:

List of proteins that are targets for 8PO

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q9K2N0_8PO Q9K2N0 Beta-lactamase (Class B n/a