Ligand name: (9cis)-retinoic acid
PDB ligand accession: 9CR
DrugBank: DB00523
PubChem: 449171
ChEMBL: CHEMBL705
InChI Key: SHGAZHPCJJPHSC-ZVCIMWCZSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Retinoids

List of proteins that are targets for 9CR

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P22605_9CR	P22605	Retinoic acid receptor	n/a	Kd(nM) = 7.0
2	P13631_9CR	P13631	Retinoic acid receptor	agonist	Ki(nM) = 1.0 IC50(nM) = 17.0 Kd(nM) = 0.8 EC50(nM) = 4.0
3	P10826_9CR	P10826	Retinoic acid receptor	agonist	Ki(nM) = 0.5 IC50(nM) = 7.0 Kd(nM) = 0.2 EC50(nM) = 0.8
4	P22932_9CR	P22932	Retinoic acid receptor	n/a
5	Q8T5C6_9CR	Q8T5C6	Retinoic acid receptor	n/a
6	P48443_9CR	P48443	Retinoic acid receptor	agonist	Ki(nM) = 11.0 IC50(nM) = 4.0 Kd(nM) = 14.0 EC50(nM) = 4.3
7	P10632_9CR	P10632	Cytochrome P450 2C8	n/a
8	P28700_9CR	P28700	Retinoic acid receptor	n/a	IC50(nM) = 82.0 Kd(nM) = 32.0 EC50(nM) = 200.0
9	P02766_9CR	P02766	Transthyretin (ATTR) (Prealbumin)	n/a
10	Q15238_9CR	Q15238	Pregnancy-specific beta-1-glycoprotein 5	n/a
11	P10276_9CR	P10276	Retinoic acid receptor	agonist	Ki(nM) = 22.0 IC50(nM) = 7.0 Kd(nM) = 0.3 EC50(nM) = 1.0
12	P06911_9CR	P06911	Epididymal-specific lipocalin-5 (Androgen-dependent	n/a
13	P19793_9CR	P19793	Retinoic acid receptor	agonist	Ki(nM) = 8.0 IC50(nM) = 29.0 Kd(nM) = 1.5 EC50(nM) = 1.5
14	Q6V0L0_9CR	Q6V0L0	Cytochrome P450 26C1	n/a
15	P28702_9CR	P28702	Retinoic acid receptor	agonist	Ki(nM) = 3.8 IC50(nM) = 12.0 Kd(nM) = 11.0 EC50(nM) = 2.6