PDB ligand accession: A1Z
DrugBank: DB12255
PubChem: 23634441;152781920;
ChEMBL:
InChI Key: JGRXMPYUTJLTKT-UHFFFAOYSA-N
SMILES: c1cc(cc(c1)Cl)c2cc(c(nc2)C(=O)NCC(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9NWT6_A1Z | Q9NWT6 | Hypoxia-inducible factor 1-alpha | n/a | |
| 2 | Q9H6Z9_A1Z | Q9H6Z9 | Prolyl hydroxylase EGLN3 | inhibitor | |
| 3 | Q16665_A1Z | Q16665 | Hypoxia-inducible factor 1-alpha | stabilization | |
| 4 | Q9GZT9_A1Z | Q9GZT9 | Egl nine homolog | inhibitor | |
| 5 | Q96KS0_A1Z | Q96KS0 | Prolyl hydroxylase EGLN2 | inhibitor | |
| 6 | Q99814_A1Z | Q99814 | Endothelial PAS domain-containing | stabilization |