PDB ligand accession: A2P
DrugBank: DB02098
PubChem:
ChEMBL:
InChI Key: AEOBEOJCBAYXBA-KQYNXXCUSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)OP(=O)(O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P12724_A2P | P12724 | Eosinophil cationic protein | n/a | |
| 2 | P61823_A2P | P61823 | Ribonuclease pancreatic (EC | n/a | |
| 3 | P07998_A2P | P07998 | Ribonuclease pancreatic (EC | n/a | |
| 4 | P00455_A2P | P00455 | Ferredoxin--NADP reductase, chloroplastic | n/a | |
| 5 | P16330_A2P | P16330 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase (CNP) | n/a | |
| 6 | O57899_A2P | O57899 | Probable RNA 2'-phosphotransferase | n/a | |
| 7 | P96789_A2P | P96789 | 6-phosphogluconate dehydrogenase, decarboxylating | n/a | |
| 8 | P08200_A2P | P08200 | Isocitrate dehydrogenase [NADP] | n/a | |
| 9 | Q9L6V3_A2P | Q9L6V3 | Flavodoxin/ferredoxin--NADP reductase (EC | n/a | |
| 10 | Q1RD16_A2P | Q1RD16 | Isocitrate dehydrogenase [NADP] | n/a | |
| 11 | P10153_A2P | P10153 | Non-secretory ribonuclease (EC | n/a | |
| 12 | A5MTN0_A2P | A5MTN0 | deleted | n/a | |
| 13 | A2T1W7_A2P | A2T1W7 | Aldose reductase | n/a | |
| 14 | C6KT68_A2P | C6KT68 | Ferredoxin--NADP reductase, apicoplast | n/a | |
| 15 | Q6LF82_A2P | Q6LF82 | deleted | n/a | |
| 16 | Q8DQ00_A2P | Q8DQ00 | Aspartate-semialdehyde dehydrogenase (ASA | n/a | |
| 17 | B3F2X4_A2P | B3F2X4 | Protein VP3 [Includes: | n/a | |
| 18 | P19097_A2P | P19097 | Fatty acid synthase | n/a | |
| 19 | V9M398_A2P | V9M398 | Disease resistance protein | n/a |