PDB ligand accession: ACD
DrugBank: DB04557
PubChem:
ChEMBL:
InChI Key: YZXBAPSDXZZRGB-DOFZRALJSA-N
SMILES: CCCCCC=CCC=CCC=CCC=CCCCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acids and conjugates
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P05979_ACD | P05979 | Prostaglandin G/H synthase | n/a | |
| 2 | D8LJ35_ACD | D8LJ35 | Polyketide Synthase III | n/a | |
| 3 | P09917_ACD | P09917 | Polyunsaturated fatty acid | n/a | |
| 4 | Q13822_ACD | Q13822 | Autotaxin (EC 3.1.4.39) | n/a | |
| 5 | A0A7Y4B3E8_ACD | A0A7Y4B3E8 | SGNH/GDSL hydrolase family | n/a | |
| 6 | P18054_ACD | P18054 | Polyunsaturated fatty acid | n/a | |
| 7 | Q4WZA5_ACD | Q4WZA5 | Hydrophobic surface binding | n/a | |
| 8 | Q1HRL7_ACD | Q1HRL7 | Odorant-binding protein 22 | n/a | |
| 9 | P04117_ACD | P04117 | Fatty acid-binding protein, | n/a | |
| 10 | P19793_ACD | P19793 | Retinoic acid receptor | n/a | |
| 11 | P02768_ACD | P02768 | Albumin | n/a | |
| 12 | A0A093VKV7_ACD | A0A093VKV7 | Envelope glycoprotein | n/a | |
| 13 | P29498_ACD | P29498 | 14 kDa fatty | n/a | |
| 14 | P05413_ACD | P05413 | Fatty acid-binding protein, | n/a | |
| 15 | Q9I9P7_ACD | Q9I9P7 | Extracellular fatty acid-binding | n/a | |
| 16 | P23219_ACD | P23219 | Prostaglandin G/H synthase | inhibitor | |
| 17 | Q96RI1_ACD | Q96RI1 | Bile acid receptor | ligand | |
| 18 | P02791_ACD | P02791 | Ferritin light chain | n/a | |
| 19 | Q05769_ACD | Q05769 | Prostaglandin G/H synthase | n/a | |
| 20 | O16025_ACD | O16025 | Allene oxide synthase-lipoxygenase | n/a | |
| 21 | P37231_ACD | P37231 | Peroxisome proliferator-activated receptor | n/a | |
| 22 | Q07869_ACD | Q07869 | Peroxisome proliferator-activated receptor | n/a |