PDB ligand accession: AG7
DrugBank: DB02313
PubChem:
ChEMBL: n/a
InChI Key: LMIUALQNZXJHOG-IFILWLFVSA-N
SMILES: CCOC(=O)CCC(CC1CCNC1=O)NC(=O)C(Cc2ccc(cc2)F)CC(=O)C(C(C)C)NC(=O)c3cc(on3)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A0M3PZC0_AG7 | A0A0M3PZC0 | Genome polyprotein [Cleaved | n/a | |
2 | E0WWC7_AG7 | E0WWC7 | Genome polyprotein [Cleaved | n/a | |
3 | A9XG43_AG7 | A9XG43 | Genome polyprotein [Cleaved | n/a | |
4 | C8CIL7_AG7 | C8CIL7 | Genome polyprotein | n/a | |
5 | A0A2K8BQT2_AG7 | A0A2K8BQT2 | Genome polyprotein [Cleaved | n/a | |
6 | A0A7L9RWV7_AG7 | A0A7L9RWV7 | deleted | n/a | |
7 | E5D8F2_AG7 | E5D8F2 | Genome polyprotein [Cleaved | n/a | |
8 | P04936_AG7 | P04936 | Genome polyprotein [Cleaved | n/a | |
9 | E7E815_AG7 | E7E815 | Genome polyprotein | n/a | |
10 | P0DTD1_AG7 | P0DTD1 | Replicase polyprotein 1ab | n/a | |
11 | Q5DSM6_AG7 | Q5DSM6 | Genome polyprotein [Cleaved | n/a |