PDB ligand accession: AYV
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: NLGYHTMGWVQQIL-UHFFFAOYSA-N
SMILES: CC(CO)(CO)NC(=O)Nc1ccccc1
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: N-phenylureas
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q6PJP8_AYV | Q6PJP8 | DNA cross-link repair | n/a | |
| 2 | P81947_AYV | P81947 | Tubulin alpha-1B chain | n/a | |
| 3 | Q8WS26_AYV | Q8WS26 | Farnesyl diphosphate synthase | n/a | |
| 4 | Q6B856_AYV | Q6B856 | Tubulin beta-2B chain | n/a | |
| 5 | Q9Y2J2_AYV | Q9Y2J2 | Band 4.1-like protein | n/a |