PDB ligand accession: B4P
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: YOAHKNVSNCMZGQ-XPWFQUROSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: (5'->5')-dinucleotides
- Subclass: None
- Class: (5'->5')-dinucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O43809_B4P | O43809 | Cleavage and polyadenylation | n/a | |
2 | O66548_B4P | O66548 | AP4A hydrolase | n/a | |
3 | P0A8N5_B4P | P0A8N5 | Lysine--tRNA ligase, heat | n/a | |
4 | A0A3K0QF38_B4P | A0A3K0QF38 | RNA pyrophosphohydrolase (EC | n/a | |
5 | O06961_B4P | O06961 | Propionate kinase (EC | n/a | |
6 | P22108_B4P | P22108 | Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase | n/a | |
7 | Q9X024_B4P | Q9X024 | Bifunctional NAD(P)H-hydrate repair | n/a | |
8 | P00568_B4P | P00568 | Adenylate kinase isoenzyme | n/a | |
9 | P10153_B4P | P10153 | Non-secretory ribonuclease (EC | n/a | |
10 | Q9RHV9_B4P | Q9RHV9 | Lysine--tRNA ligase (EC | n/a | |
11 | Q8XIQ9_B4P | Q8XIQ9 | Cobalt-dependent inorganic pyrophosphatase | n/a | |
12 | P41250_B4P | P41250 | Glycine--tRNA ligase (EC | n/a | |
13 | P21879_B4P | P21879 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
14 | P94368_B4P | P94368 | ADP-dependent (S)-NAD(P)H-hydrate dehydratase | n/a | |
15 | P49902_B4P | P49902 | Cytosolic purine 5'-nucleotidase | n/a | |
16 | P49773_B4P | P49773 | Adenosine 5'-monophosphoramidase HINT1 | n/a | |
17 | P97675_B4P | P97675 | Ectonucleotide pyrophosphatase/phosphodiesterase family | n/a | |
18 | P54819_B4P | P54819 | Adenylate kinase 2, | n/a |