PDB ligand accession: B8L
DrugBank: DB02155
PubChem:
ChEMBL: n/a
InChI Key: XVLMXAUKCDSMMW-YXLARRHKSA-N
SMILES: CCC(C)c1cc(ccc1O)C(=O)NC2CNCCCC2OC(=O)c3ccc(cc3)C(=O)c4cc(ccc4O)OC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzophenones
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P17612_B8L | P17612 | cAMP-dependent protein kinase | n/a | |
| 2 | P05132_B8L | P05132 | cAMP-dependent protein kinase | n/a |