PDB ligand accession: B9Z
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: KSEPBMMZVPGILK-NRFANRHFSA-N
SMILES: COc1ccc(cc1)c2ccc(cc2)Sc3ccccc3C(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Biphenyls and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P14780_B9Z | P14780 | Matrix metalloproteinase-9 (MMP-9) | n/a | |
| 2 | P39900_B9Z | P39900 | Macrophage metalloelastase (MME) | n/a |