PDB ligand accession: BES
DrugBank: DB03424
PubChem: 72172;6992132;
ChEMBL:
InChI Key: VGGGPCQERPFHOB-RDBSUJKOSA-N
SMILES: CC(C)CC(C(=O)O)NC(=O)C(C(Cc1ccccc1)N)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Peptidomimetics
- Subclass: Hybrid peptides
- Class: Peptidomimetics
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q6IP81_BES | Q6IP81 | Leukotriene A-4 hydrolase | n/a | |
| 2 | P04825_BES | P04825 | Aminopeptidase N (EC | n/a | |
| 3 | Q8IL11_BES | Q8IL11 | Leucine aminopeptidase (PfLAP) | n/a | |
| 4 | Q385B0_BES | Q385B0 | Aminopeptidase, putative | n/a | |
| 5 | P09960_BES | P09960 | Leukotriene A-4 hydrolase | inhibitor | |
| 6 | Q01693_BES | Q01693 | Bacterial leucyl aminopeptidase | n/a | |
| 7 | O25294_BES | O25294 | Cytosol aminopeptidase (EC | n/a | |
| 8 | Q9NZ08_BES | Q9NZ08 | Endoplasmic reticulum aminopeptidase | n/a | |
| 9 | A2V759_BES | A2V759 | Aminopeptidase | n/a | |
| 10 | Q10740_BES | Q10740 | Leucine aminopeptidase 2 | n/a | |
| 11 | O96935_BES | O96935 | Aminopeptidase N (EC | n/a | |
| 12 | Q96KP4_BES | Q96KP4 | Cytosolic non-specific dipeptidase | n/a | |
| 13 | P15144_BES | P15144 | Aminopeptidase N (AP-N) | n/a | |
| 14 | Q9D1A2_BES | Q9D1A2 | Cytosolic non-specific dipeptidase | n/a | |
| 15 | Q07075_BES | Q07075 | Glutamyl aminopeptidase (EAP) | n/a | |
| 16 | Q02RY8_BES | Q02RY8 | Probable cytosol aminopeptidase | n/a | |
| 17 | P15145_BES | P15145 | Aminopeptidase N (AP-N) | n/a | |
| 18 | O86436_BES | O86436 | Cytosol aminopeptidase (EC | n/a |