PDB ligand accession: BIO
DrugBank: DB03886
PubChem: 444475;5287790;135449517;
ChEMBL: n/a
InChI Key: LHQIJBMDNUYRAM-AWFVSMACSA-N
SMILES: CC(C(c1cnc2c(n1)C(=O)NC(=N2)N)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | C6KTB6_BIO | C6KTB6 | 6-pyruvoyltetrahydropterin synthase (EC | n/a | |
2 | P35270_BIO | P35270 | Sepiapterin reductase (SPR) | n/a | |
3 | A5K2B2_BIO | A5K2B2 | 6-pyruvoyltetrahydropterin synthase (EC | n/a | |
4 | Q64105_BIO | Q64105 | Sepiapterin reductase (SPR) | n/a | |
5 | P00374_BIO | P00374 | Dihydrofolate reductase (EC | n/a | |
6 | Q03393_BIO | Q03393 | 6-pyruvoyl tetrahydrobiopterin synthase | n/a | |
7 | P27213_BIO | P27213 | 6-pyruvoyl tetrahydrobiopterin synthase | n/a | |
8 | Q8KES3_BIO | Q8KES3 | Sepiapterin reductase (SPR) | n/a | |
9 | C6EJA7_BIO | C6EJA7 | deleted | n/a |