PDB ligand accession: C2F
DrugBank: DB11256
PubChem: 444412;5287865;135398561;
ChEMBL:
InChI Key: ZNOVTXRBGFNYRX-STQMWFEESA-N
SMILES: CN1C(CNC2=C1C(=O)NC(=N2)N)CNc3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0AEZ1_C2F | P0AEZ1 | 5,10-methylenetetrahydrofolate reductase (MTHFR) | n/a | |
2 | P67044_C2F | P67044 | Thymidylate synthase (TS) | n/a | |
3 | Q46389_C2F | Q46389 | 5-methyltetrahydrofolate:corrinoid/iron-sulfur protein co-methyltransferase | n/a | |
4 | Q9WYA5_C2F | Q9WYA5 | Methionine synthase (EC | n/a | |
5 | Q9X112_C2F | Q9X112 | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase (EC | n/a | |
6 | B8FW00_C2F | B8FW00 | Dihydropteroate synthase DHPS | n/a | |
7 | Q3ACR9_C2F | Q3ACR9 | 5-methyltetrahydrofolate corrinoid/iron sulfur | n/a | |
8 | P82610_C2F | P82610 | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase (EC | n/a | |
9 | P13255_C2F | P13255 | Glycine N-methyltransferase (EC | n/a | |
10 | P27248_C2F | P27248 | Aminomethyltransferase (EC 2.1.2.10) | n/a | |
11 | P42326_C2F | P42326 | Thymidylate synthase 1 | n/a | |
12 | Q544L2_C2F | Q544L2 | Thymidylate synthase (EC | n/a | |
13 | O50008_C2F | O50008 | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 | n/a | |
14 | P00470_C2F | P00470 | Thymidylate synthase (TS) | n/a | |
15 | Q5SKM5_C2F | Q5SKM5 | Methionine synthase (EC | n/a | |
16 | P00394_C2F | P00394 | 5,10-methylenetetrahydrofolate reductase (MTHFR) | n/a | |
17 | A3DHS7_C2F | A3DHS7 | Methylenetetrahydrofolate reductase | n/a |