PDB ligand accession: CBY
DrugBank: n/a
PubChem: 5460147;49866763;50930266;
ChEMBL: n/a
InChI Key: GFVWZOGCSKVPRA-JFYQDRLCSA-M
SMILES: CC1=C2C(C(C3[N-]2[Co+2]45[N]6=C1C(C(C6=CC7=[N]4C(=C(C8=[N]5C3(C(C8CCC(=O)N)(C)CC(=O)N)C)C)C(C7CCC(=O)N)(C)CC(=O)N)(C)C)CCC(=O)N)CC(=O)N)(C)CCC(=O)NCC(C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P20061_CBY | P20061 | Transcobalamin-1 (TC-1) (Haptocorrin) | n/a | |
2 | P20062_CBY | P20062 | Transcobalamin-2 (TC-2) (Transcobalamin | n/a | |
3 | Q50EJ2_CBY | Q50EJ2 | Corrinoid adenosyltransferase (EC | n/a | |
4 | P37028_CBY | P37028 | Vitamin B12-binding protein | n/a | |
5 | P0A910_CBY | P0A910 | Outer membrane protein | n/a | |
6 | Q8A6D0_CBY | Q8A6D0 | Surface layer protein | n/a |