PDB ligand accession: CDP
DrugBank: DB04555
PubChem:
ChEMBL:
InChI Key: ZWIADYZPOWUWEW-XVFCMESISA-N
SMILES: C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Pyrimidine nucleotides
- Subclass: Pyrimidine ribonucleotides
- Class: Pyrimidine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q99IB8_CDP | Q99IB8 | Genome polyprotein [Cleaved | n/a | |
| 2 | Q1CVJ4_CDP | Q1CVJ4 | Chromosome-partitioning protein ParB | n/a | |
| 3 | Q9H9S5_CDP | Q9H9S5 | Ribitol 5-phosphate transferase | n/a | |
| 4 | I7FJF7_CDP | I7FJF7 | 8-oxo-dGTP diphosphatase (EC | n/a | |
| 5 | Q5HFV4_CDP | Q5HFV4 | Nucleoside diphosphate kinase | n/a | |
| 6 | Q7Z8P9_CDP | Q7Z8P9 | Nucleoside diphosphate kinase | n/a | |
| 7 | Q63T71_CDP | Q63T71 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
| 8 | A1S6W5_CDP | A1S6W5 | Regulatory inactivation of | n/a | |
| 9 | D9J2T9_CDP | D9J2T9 | rRNA N-glycosylase (EC | n/a | |
| 10 | B2HP08_CDP | B2HP08 | Fido domain-containing protein | n/a | |
| 11 | O57978_CDP | O57978 | Phosphoribosylaminoimidazole-succinocarboxamide synthase (EC | n/a | |
| 12 | G4RIN4_CDP | G4RIN4 | SiaD | n/a | |
| 13 | P53131_CDP | P53131 | Pre-mRNA-splicing factor ATP-dependent | n/a | |
| 14 | P72097_CDP | P72097 | N-acetyllactosaminide alpha-2,3-sialyltransferase (EC | n/a | |
| 15 | P62617_CDP | P62617 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
| 16 | P0A0Z8_CDP | P0A0Z8 | N-acylneuraminate cytidylyltransferase (EC | n/a | |
| 17 | P23921_CDP | P23921 | Ribonucleoside-diphosphate reductase large | n/a | |
| 18 | P21524_CDP | P21524 | Ribonucleoside-diphosphate reductase large | n/a | |
| 19 | Q381H3_CDP | Q381H3 | Nucleoside diphosphate kinase | n/a | |
| 20 | P61136_CDP | P61136 | Nucleoside diphosphate kinase | n/a | |
| 21 | Q5UQL3_CDP | Q5UQL3 | Nucleoside diphosphate kinase | n/a | |
| 22 | Q8SS83_CDP | Q8SS83 | Probable cytidylate kinase | n/a | |
| 23 | P36663_CDP | P36663 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
| 24 | A0A6B7HXY7_CDP | A0A6B7HXY7 | Genome polyprotein | n/a | |
| 25 | P15424_CDP | P15424 | ATP-dependent RNA helicase | n/a | |
| 26 | O33839_CDP | O33839 | Vitamin B12-dependent ribonucleotide | n/a | |
| 27 | Q5SL35_CDP | Q5SL35 | Cytidylate kinase (CK) | n/a | |
| 28 | Q5F8Z6_CDP | Q5F8Z6 | Ribonucleoside-diphosphate reductase (EC | n/a | |
| 29 | A0R559_CDP | A0R559 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
| 30 | P00558_CDP | P00558 | Phosphoglycerate kinase 1 | n/a | |
| 31 | Q9V119_CDP | Q9V119 | Exosome complex component | n/a | |
| 32 | P9WPQ5_CDP | P9WPQ5 | Dethiobiotin synthetase BioD | n/a | |
| 33 | O67060_CDP | O67060 | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase (CMK) | n/a | |
| 34 | P42216_CDP | P42216 | 3-deoxy-manno-octulosonate cytidylyltransferase (EC | n/a | |
| 35 | D2SNF7_CDP | D2SNF7 | Cytidylyl-2-hydroxypropylphosphonate hydrolase (EC | n/a | |
| 36 | O43173_CDP | O43173 | Alpha-N-acetylneuraminate alpha-2,8-sialyltransferase ST8SIA3 | n/a | |
| 37 | Q9HUM0_CDP | Q9HUM0 | RNA-binding protein Hfq | n/a | |
| 38 | P0A6I0_CDP | P0A6I0 | Cytidylate kinase (CK) | n/a | |
| 39 | P26497_CDP | P26497 | Stage 0 sporulation | n/a | |
| 40 | Q5I3C1_CDP | Q5I3C1 | Genome polyprotein | n/a | |
| 41 | P19913_CDP | P19913 | Carbon monoxide dehydrogenase | n/a | |
| 42 | P62368_CDP | P62368 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, | n/a | |
| 43 | P00452_CDP | P00452 | Ribonucleoside-diphosphate reductase 1 | n/a | |
| 44 | Q60365_CDP | Q60365 | Riboflavin kinase (RFK) | n/a | |
| 45 | P14169_CDP | P14169 | CDP-paratose 2-epimerase (EC | n/a | |
| 46 | Q9V118_CDP | Q9V118 | Exosome complex component | n/a | |
| 47 | O27985_CDP | O27985 | CDP-alcohol phosphatidyltransferase AF-2299-like | n/a | |
| 48 | Q8RQP5_CDP | Q8RQP5 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
| 49 | Q6A562_CDP | Q6A562 | RNA-dependent RNA polymerase | n/a |