PDB ligand accession: CLR
DrugBank: DB04540
PubChem:
ChEMBL:
InChI Key: HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES: CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Steroids and steroid derivatives
- Subclass: Cholestane steroids
- Class: Steroids and steroid derivatives
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q70Q12_CLR | Q70Q12 | FXYD domain-containing ion | n/a | |
| 2 | P29275_CLR | P29275 | Adenosine receptor A2b | n/a | |
| 3 | P02730_CLR | P02730 | Band 3 anion | n/a | |
| 4 | Q86Y34_CLR | Q86Y34 | Adhesion G protein-coupled | n/a | |
| 5 | Q9BXC1_CLR | Q9BXC1 | Probable G-protein coupled | n/a | |
| 6 | P21728_CLR | P21728 | D(1A) dopamine receptor | n/a | |
| 7 | Q8IWT6_CLR | Q8IWT6 | Volume-regulated anion channel | n/a | |
| 8 | Q13936-20_CLR | Q13936-20 | n/a | ||
| 9 | G3V8S4_CLR | G3V8S4 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 10 | I7HD36_CLR | I7HD36 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 11 | P69332_CLR | P69332 | G-protein coupled receptor | n/a | |
| 12 | P25106_CLR | P25106 | Atypical chemokine receptor | n/a | |
| 13 | Q96RJ0_CLR | Q96RJ0 | Trace amine-associated receptor | n/a | |
| 14 | Q02643_CLR | Q02643 | Growth hormone-releasing hormone | n/a | |
| 15 | P32241_CLR | P32241 | Vasoactive intestinal polypeptide | n/a | |
| 16 | P61916_CLR | P61916 | NPC intracellular cholesterol | n/a | |
| 17 | Q96BI3_CLR | Q96BI3 | Gamma-secretase subunit APH-1A | n/a | |
| 18 | A0A0B4KEX2_CLR | A0A0B4KEX2 | Transporter | n/a | |
| 19 | P47900_CLR | P47900 | P2Y purinoceptor 1 | n/a | |
| 20 | P02710_CLR | P02710 | Acetylcholine receptor subunit | n/a | |
| 21 | P41143_CLR | P41143 | Delta-type opioid receptor | n/a | |
| 22 | P13866_CLR | P13866 | Sodium/glucose cotransporter 1 | n/a | |
| 23 | P23978_CLR | P23978 | Sodium- and chloride-dependent | n/a | |
| 24 | Q9H244_CLR | Q9H244 | P2Y purinoceptor 12 | n/a | |
| 25 | Q7K4Y6_CLR | Q7K4Y6 | Sodium-dependent dopamine transporter | n/a | |
| 26 | P21462_CLR | P21462 | fMet-Leu-Phe receptor (fMLP | n/a | |
| 27 | P27449_CLR | P27449 | V-type proton ATPase | n/a | |
| 28 | P35372_CLR | P35372 | Mu-type opioid receptor | n/a | |
| 29 | Q80KM9_CLR | Q80KM9 | Envelope protein US28 | n/a | |
| 30 | P07550_CLR | P07550 | Beta-2 adrenergic receptor | n/a | |
| 31 | P23945_CLR | P23945 | Follicle-stimulating hormone receptor | n/a | |
| 32 | P29274_CLR | P29274 | Adenosine receptor A2a | n/a | |
| 33 | Q14833_CLR | Q14833 | Metabotropic glutamate receptor | n/a | |
| 34 | P48039_CLR | P48039 | Melatonin receptor type | n/a | |
| 35 | P31645_CLR | P31645 | Sodium-dependent serotonin transporter | n/a | |
| 36 | P30550_CLR | P30550 | Gastrin-releasing peptide receptor | n/a | |
| 37 | Q15465_CLR | Q15465 | Sonic hedgehog protein | n/a | |
| 38 | P11473_CLR | P11473 | Vitamin D3 receptor | n/a | |
| 39 | P60033_CLR | P60033 | CD81 antigen (26 | n/a | |
| 40 | Q13324_CLR | Q13324 | Corticotropin-releasing factor receptor | n/a | |
| 41 | P36544_CLR | P36544 | Neuronal acetylcholine receptor | n/a | |
| 42 | P19491_CLR | P19491 | Glutamate receptor 2 | n/a | |
| 43 | Q14994_CLR | Q14994 | Nuclear receptor subfamily | n/a | |
| 44 | Q9WTR1_CLR | Q9WTR1 | Transient receptor potential | n/a | |
| 45 | Q5L1G5_CLR | Q5L1G5 | Amino acid transporter | n/a | |
| 46 | Q08DA1_CLR | Q08DA1 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 47 | P30556_CLR | P30556 | Type-1 angiotensin II | n/a | |
| 48 | Q12791_CLR | Q12791 | Calcium-activated potassium channel | n/a | |
| 49 | O64989_CLR | O64989 | Steroid (22S)-hydroxylase (EC | n/a | |
| 50 | Q9Y5Y9_CLR | Q9Y5Y9 | Sodium channel protein | n/a | |
| 51 | P15570_CLR | P15570 | Beta-elicitin cryptogein (CRY) | n/a | |
| 52 | P02712_CLR | P02712 | Acetylcholine receptor subunit | n/a | |
| 53 | P25090_CLR | P25090 | N-formyl peptide receptor | n/a | |
| 54 | P13569_CLR | P13569 | Cystic fibrosis transmembrane | n/a | |
| 55 | P21439_CLR | P21439 | Phosphatidylcholine translocator ABCB4 | n/a | |
| 56 | Q14108_CLR | Q14108 | Lysosome membrane protein | n/a | |
| 57 | P78423_CLR | P78423 | Fractalkine (C-X3-C motif | n/a | |
| 58 | P25025_CLR | P25025 | C-X-C chemokine receptor | n/a | |
| 59 | P45844_CLR | P45844 | ATP-binding cassette sub-family | n/a | |
| 60 | A0A5G2QYH2_CLR | A0A5G2QYH2 | deleted | n/a | |
| 61 | P58743_CLR | P58743 | Prestin (Solute carrier | n/a | |
| 62 | P41145_CLR | P41145 | Kappa-type opioid receptor | n/a | |
| 63 | Q9UBS5_CLR | Q9UBS5 | Gamma-aminobutyric acid type | n/a | |
| 64 | O95342_CLR | O95342 | Bile salt export | n/a | |
| 65 | Q8N6U8_CLR | Q8N6U8 | G-protein coupled receptor | n/a | |
| 66 | P35398_CLR | P35398 | Nuclear receptor ROR-alpha | n/a | |
| 67 | Q14832_CLR | Q14832 | Metabotropic glutamate receptor | n/a | |
| 68 | P20963_CLR | P20963 | T-cell surface glycoprotein | n/a | |
| 69 | P49238_CLR | P49238 | CX3C chemokine receptor | n/a | |
| 70 | Q14416_CLR | Q14416 | Metabotropic glutamate receptor | n/a | |
| 71 | A7T1N0_CLR | A7T1N0 | Transient receptor potential | n/a | |
| 72 | A0A0C4DFX6_CLR | A0A0C4DFX6 | NPC1 like intracellular | n/a | |
| 73 | Q58K79_CLR | Q58K79 | FXYD domain-containing ion | n/a | |
| 74 | P54708_CLR | P54708 | Potassium-transporting ATPase alpha | n/a | |
| 75 | A0A1Z2R994_CLR | A0A1Z2R994 | Structural polyprotein (p130) | n/a | |
| 76 | Q8TDU6_CLR | Q8TDU6 | G-protein coupled bile | n/a | |
| 77 | P28335_CLR | P28335 | 5-hydroxytryptamine receptor 2C | n/a | |
| 78 | P34972_CLR | P34972 | Cannabinoid receptor 2 | n/a | |
| 79 | Q9NS75_CLR | Q9NS75 | Cysteinyl leukotriene receptor | n/a | |
| 80 | O43603_CLR | O43603 | Galanin receptor type | n/a | |
| 81 | P54826_CLR | P54826 | Growth arrest-specific protein | n/a | |
| 82 | Q8HXQ5_CLR | Q8HXQ5 | Multidrug resistance-associated protein | n/a | |
| 83 | P0ABE7_CLR | P0ABE7 | Soluble cytochrome b562 | n/a | |
| 84 | Q9NRK6_CLR | Q9NRK6 | ATP-binding cassette sub-family | n/a | |
| 85 | P25103_CLR | P25103 | Substance-P receptor (SPR) | n/a | |
| 86 | Q96RD7_CLR | Q96RD7 | Pannexin-1 (PANX1) [Cleaved | n/a | |
| 87 | Q96KN9_CLR | Q96KN9 | Gap junction delta-4 | n/a | |
| 88 | Q6CUK7_CLR | Q6CUK7 | KLLA0C04147p | n/a | |
| 89 | P07340_CLR | P07340 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 90 | Q9GZN0_CLR | Q9GZN0 | G protein-coupled receptor | n/a | |
| 91 | Q9NB97_CLR | Q9NB97 | Sodium-dependent dopamine transporter | n/a | |
| 92 | P34998_CLR | P34998 | Corticotropin-releasing factor receptor | n/a | |
| 93 | Q9BXW6_CLR | Q9BXW6 | Oxysterol-binding protein-related protein | n/a | |
| 94 | Q5T848_CLR | Q5T848 | Metabotropic glycine receptor | n/a | |
| 95 | P22059_CLR | P22059 | Oxysterol-binding protein 1 | n/a | |
| 96 | Q01118_CLR | Q01118 | Sodium channel protein | n/a | |
| 97 | O43613_CLR | O43613 | Orexin/Hypocretin receptor type | n/a | |
| 98 | P05108_CLR | P05108 | Cholesterol side-chain cleavage | n/a | |
| 99 | Q03431_CLR | Q03431 | Parathyroid hormone/parathyroid hormone-related | n/a | |
| 100 | Q98SW5_CLR | Q98SW5 | Protein smoothened | n/a | |
| 101 | Q8TDS4_CLR | Q8TDS4 | Hydroxycarboxylic acid receptor | n/a | |
| 102 | P48546_CLR | P48546 | Gastric inhibitory polypeptide | n/a | |
| 103 | P19156_CLR | P19156 | Potassium-transporting ATPase alpha | n/a | |
| 104 | P48547_CLR | P48547 | Voltage-gated potassium channel | n/a | |
| 105 | Q9UHC9_CLR | Q9UHC9 | NPC1-like intracellular cholesterol | n/a | |
| 106 | P43004_CLR | P43004 | Excitatory amino acid | n/a | |
| 107 | P42866_CLR | P42866 | Mu-type opioid receptor | n/a | |
| 108 | Q9H3N8_CLR | Q9H3N8 | Histamine H4 receptor | n/a | |
| 109 | C4IX13_CLR | C4IX13 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 110 | Q3MHW7_CLR | Q3MHW7 | Sigma intracellular receptor | n/a | |
| 111 | D2WKD6_CLR | D2WKD6 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 112 | Q4H132_CLR | Q4H132 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 113 | P02718_CLR | P02718 | Acetylcholine receptor subunit | n/a | |
| 114 | O15118_CLR | O15118 | NPC intracellular cholesterol | n/a | |
| 115 | Q99788_CLR | Q99788 | Chemerin-like receptor 1 | n/a | |
| 116 | P02724_CLR | P02724 | Glycophorin-A (MN sialoglycoprotein) | n/a | |
| 117 | Q04645_CLR | Q04645 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 118 | Q15878_CLR | Q15878 | Voltage-dependent R-type calcium | n/a | |
| 119 | P30518_CLR | P30518 | Vasopressin V2 receptor | n/a | |
| 120 | P41180-1_CLR | P41180-1 | n/a | ||
| 121 | Q9NUT2_CLR | Q9NUT2 | Mitochondrial potassium channel | n/a | |
| 122 | Q14973_CLR | Q14973 | Hepatic sodium/bile acid | n/a | |
| 123 | Q8NFT2_CLR | Q8NFT2 | Metalloreductase STEAP2 (EC | n/a | |
| 124 | Q9UPC5_CLR | Q9UPC5 | Probable G-protein coupled | n/a | |
| 125 | Q92847_CLR | Q92847 | Growth hormone secretagogue | n/a | |
| 126 | P05027_CLR | P05027 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 127 | P21554_CLR | P21554 | Cannabinoid receptor 1 | n/a | |
| 128 | Q9H222_CLR | Q9H222 | ATP-binding cassette sub-family | n/a | |
| 129 | P47211_CLR | P47211 | Galanin receptor type | n/a | |
| 130 | Q03720_CLR | Q03720 | Calcium-activated potassium channel | n/a | |
| 131 | D9IEF7_CLR | D9IEF7 | Endolysin (EC 3.2.1.17) | n/a | |
| 132 | Q9HC97_CLR | Q9HC97 | G-protein coupled receptor | n/a | |
| 133 | P30411_CLR | P30411 | B2 bradykinin receptor | n/a | |
| 134 | A4IGB6_CLR | A4IGB6 | Receptor for retinol | n/a | |
| 135 | Q01650_CLR | Q01650 | Large neutral amino | n/a | |
| 136 | F1RM59_CLR | F1RM59 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 137 | P28223_CLR | P28223 | 5-hydroxytryptamine receptor 2A | n/a | |
| 138 | Q96LB1_CLR | Q96LB1 | Mas-related G-protein coupled | n/a | |
| 139 | P56726_CLR | P56726 | Protein smoothened | n/a | |
| 140 | Q9H221_CLR | Q9H221 | ATP-binding cassette sub-family | n/a | |
| 141 | P18434_CLR | P18434 | Potassium-transporting ATPase subunit | n/a | |
| 142 | O75899_CLR | O75899 | Gamma-aminobutyric acid type | n/a | |
| 143 | P05106_CLR | P05106 | Integrin beta-3 (Platelet | n/a | |
| 144 | Q99835_CLR | Q99835 | Protein smoothened (Protein | n/a | |
| 145 | Q9ULY5_CLR | Q9ULY5 | C-type lectin domain | ligand | |
| 146 | Q13563_CLR | Q13563 | Polycystin-2 (PC2) (Autosomal | n/a | |
| 147 | Q6IYF9_CLR | Q6IYF9 | Succinate receptor 1 | n/a | |
| 148 | P29972_CLR | P29972 | Aquaporin-1 (AQP-1) (Aquaporin-CHIP) | n/a | |
| 149 | I0YUS5_CLR | I0YUS5 | Family A G | n/a | |
| 150 | Q12675_CLR | Q12675 | Phospholipid-transporting ATPase DNF2 | n/a | |
| 151 | Q16581_CLR | Q16581 | C3a anaphylatoxin chemotactic | n/a | |
| 152 | Q02094_CLR | Q02094 | Ammonium transporter Rh | n/a | |
| 153 | P30559_CLR | P30559 | Oxytocin receptor (OT-R) | n/a | |
| 154 | P30874_CLR | P30874 | Somatostatin receptor type | n/a | |
| 155 | P08034_CLR | P08034 | Gap junction beta-1 | n/a | |
| 156 | Q9Y5N1_CLR | Q9Y5N1 | Histamine H3 receptor | n/a | |
| 157 | P51686_CLR | P51686 | C-C chemokine receptor | n/a | |
| 158 | P33897_CLR | P33897 | ATP-binding cassette sub-family | n/a | |
| 159 | Q9V2J8_CLR | Q9V2J8 | Glycogen synthase | n/a | |
| 160 | A0A6P3EL78_CLR | A0A6P3EL78 | Uncharacterized protein | n/a | |
| 161 | P35844_CLR | P35844 | Oxysterol-binding protein homolog | n/a | |
| 162 | M1MR49_CLR | M1MR49 | Japanin (18 kDa | n/a | |
| 163 | Q8N697_CLR | Q8N697 | Solute carrier family | n/a | |
| 164 | P32246_CLR | P32246 | C-C chemokine receptor | n/a | |
| 165 | G1K3Q0_CLR | G1K3Q0 | Rhodopsin-2 | n/a | |
| 166 | Q9UNQ0_CLR | Q9UNQ0 | Broad substrate specificity | n/a | |
| 167 | P29973_CLR | P29973 | Cyclic nucleotide-gated channel | n/a | |
| 168 | P05024_CLR | P05024 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 169 | P16452_CLR | P16452 | Protein 4.2 (P4.2) | n/a | |
| 170 | P02714_CLR | P02714 | Acetylcholine receptor subunit | n/a | |
| 171 | P43220_CLR | P43220 | Glucagon-like peptide 1 | n/a | |
| 172 | P49190_CLR | P49190 | Parathyroid hormone 2 | n/a | |
| 173 | P51449_CLR | P51449 | Nuclear receptor ROR-gamma | n/a | |
| 174 | Q5T601_CLR | Q5T601 | Adhesion G-protein coupled | n/a | |
| 175 | P08183_CLR | P08183 | ATP-dependent translocase ABCB1 | n/a | |
| 176 | P41180_CLR | P41180 | Extracellular calcium-sensing receptor | n/a | |
| 177 | P16473_CLR | P16473 | Thyrotropin receptor (Thyroid-stimulating | n/a | |
| 178 | P24530_CLR | P24530 | Endothelin receptor type | n/a | |
| 179 | P41595_CLR | P41595 | 5-hydroxytryptamine receptor 2B | n/a | |
| 180 | Q13936_CLR | Q13936 | Voltage-dependent L-type calcium | n/a |