PDB ligand accession: COO
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: KFWWCMJSYSSPSK-XBTRWLRFSA-N
SMILES: CC=CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acyl thioesters
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9SRR8_COO | Q9SRR8 | 2Fe-2S ferredoxin-like superfamily | n/a | |
2 | Q8WZM3_COO | Q8WZM3 | Enoyl-[acyl-carrier-protein] reductase 1, | n/a | |
3 | P30084_COO | P30084 | Enoyl-CoA hydratase, mitochondrial | n/a | |
4 | Q9SMN1_COO | Q9SMN1 | Gamma carbonic anhydrase-like | n/a | |
5 | B7TVP1_COO | B7TVP1 | Glutaconyl-CoA decarboxylase subunit | n/a | |
6 | O95251_COO | O95251 | Histone acetyltransferase KAT7 | n/a | |
7 | A0A384LA38_COO | A0A384LA38 | (thale cress) hypothetical | n/a | |
8 | P77455_COO | P77455 | Bifunctional protein PaaZ | n/a | |
9 | P96202_COO | P96202 | Phenolphthiocerol/phthiocerol polyketide synthase | n/a | |
10 | Q09472_COO | Q09472 | Histone acetyltransferase p300 | n/a |