Ligand name: 2,4-DIAMINO-6-[N-(3',5'-DIMETHOXYBENZYL)-N-METHYLAMINO]PYRIDO[2,3-D]PYRIMIDINE
PDB ligand accession: COQ
DrugBank: DB03987
PubChem: 447022
ChEMBL: CHEMBL36245
InChI Key: XWCCXDBXMCTZPW-UHFFFAOYSA-N
SMILES: CN(Cc1cc(cc(c1)OC)OC)c2cc3c(nc(nc3nc2)N)N

ClassyFire chemical classification:

List of proteins that are targets for COQ

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P16184_COQ P16184 Dihydrofolate reductase (EC n/a IC50(nM) = 76.0
2 P00374_COQ P00374 Dihydrofolate reductase (EC n/a IC50(nM) = 2900.0