PDB ligand accession: COY
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: KWGNLVVAVJCVFN-OGKXECBZSA-N
SMILES: Cc1cc2c(cc1C)n(cn2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C7=C(C8C(C(C9=CC1C(C(C2=C(C4[N-]5[Co+2](N12)(N89)(N76)CCCCCn1cnc2c1ncnc2N)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Corrinoids
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q59471_COY | Q59471 | Diol dehydrase beta | n/a | |
| 2 | P19636_COY | P19636 | Ethanolamine ammonia-lyase small | n/a | |
| 3 | Q59470_COY | Q59470 | Diol dehydrase alpha | n/a | |
| 4 | P0AEJ6_COY | P0AEJ6 | Ethanolamine ammonia-lyase large | n/a |