PDB ligand accession: CPB
DrugBank: DB03496
PubChem:
ChEMBL:
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CCC(C(C1)O)c2c(cc(c3c2OC(=CC3=O)c4ccccc4Cl)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Flavonoids
- Subclass: Flavones
- Class: Flavonoids
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P11217_CPB | P11217 | Glycogen phosphorylase, muscle | inhibitor | IC50(nM) = 1000.0 |
2 | P00489_CPB | P00489 | Glycogen phosphorylase, muscle | n/a | IC50(nM) = 1200.0 |
3 | P11802_CPB | P11802 | Cyclin-dependent kinase 4 | n/a | Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 3.3 |
4 | P06493_CPB | P06493 | Cyclin-dependent kinase 1 | n/a | Ki(nM) = 40.0 IC50(nM) = 10.0 |
5 | P49336_CPB | P49336 | Cyclin-dependent kinase 8 | n/a | Kd(nM) = 120.0 |
6 | P24941_CPB | P24941 | Cyclin-dependent kinase 2 | inhibitor | Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 200.0 |
7 | P11216_CPB | P11216 | Glycogen phosphorylase, brain | n/a | |
8 | P00533_CPB | P00533 | Epidermal growth factor | n/a | IC50(nM) = 21000.0 Kd(nM) = 520.0 |
9 | Q00535_CPB | Q00535 | Cyclin-dependent kinase 5 | n/a | IC50(nM) = 170.0 Kd(nM) = 43.0 |
10 | O60885_CPB | O60885 | Bromodomain-containing protein 4 | n/a | |
11 | P50750_CPB | P50750 | Cyclin-dependent kinase 9 | inhibitor | Ki(nM) = 3.0 IC50(nM) = 3.0 Kd(nM) = 6.4 |
12 | P50613_CPB | P50613 | Cyclin-dependent kinase 7 | n/a | IC50(nM) = 10.0 Kd(nM) = 23.0 |
13 | Q00534_CPB | Q00534 | Cyclin-dependent kinase 6 | n/a | IC50(nM) = 20.0 |