Ligand name: 2-(2-CHLORO-PHENYL)-5,7-DIHYDROXY-8-(3-HYDROXY-1-METHYL-PIPERIDIN-4-YL)-4H-BENZOPYRAN-4-ONE
PDB ligand accession: CPB
DrugBank: DB03496
PubChem: 5287969
ChEMBL: CHEMBL428690
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CCC(C(C1)O)c2c(cc(c3c2OC(=CC3=O)c4ccccc4Cl)O)O

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Phenylpropanoids and polyketides
    • Class: Flavonoids
      • Subclass: Flavones

List of proteins that are targets for CPB

#	DrugDomain Data	UniProt Accession	Protein name	Drug Action	Affinity data
1	P11217_CPB	P11217	Glycogen phosphorylase, muscle	inhibitor	IC50(nM) = 1000.0
2	P00489_CPB	P00489	Glycogen phosphorylase, muscle	n/a	IC50(nM) = 1200.0
3	P11802_CPB	P11802	Cyclin-dependent kinase 4	n/a	Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 3.3
4	P06493_CPB	P06493	Cyclin-dependent kinase 1	n/a	Ki(nM) = 40.0 IC50(nM) = 10.0
5	P49336_CPB	P49336	Cyclin-dependent kinase 8	n/a	Kd(nM) = 120.0
6	P24941_CPB	P24941	Cyclin-dependent kinase 2	inhibitor	Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 200.0
7	P11216_CPB	P11216	Glycogen phosphorylase, brain	n/a
8	P00533_CPB	P00533	Epidermal growth factor	n/a	IC50(nM) = 21000.0 Kd(nM) = 520.0
9	Q00535_CPB	Q00535	Cyclin-dependent kinase 5	n/a	IC50(nM) = 170.0 Kd(nM) = 43.0
10	O60885_CPB	O60885	Bromodomain-containing protein 4	n/a
11	P50750_CPB	P50750	Cyclin-dependent kinase 9	inhibitor	Ki(nM) = 3.0 IC50(nM) = 3.0 Kd(nM) = 6.4
12	P50613_CPB	P50613	Cyclin-dependent kinase 7	n/a	IC50(nM) = 10.0 Kd(nM) = 23.0
13	Q00534_CPB	Q00534	Cyclin-dependent kinase 6	n/a	IC50(nM) = 20.0