PDB ligand accession: CTE
DrugBank: n/a
PubChem: 3081936;45266734;
ChEMBL: n/a
InChI Key: DMQFGLHRDFQKNR-VIFPVBQESA-N
SMILES: c1cc2c(c[nH]c2c(c1)Cl)CC(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P95480_CTE | P95480 | Tryptophan 7-halogenase PrnA | n/a | |
2 | P95481_CTE | P95481 | Monodechloroaminopyrrolnitrin synthase PrnB | n/a |