PDB ligand accession: CTX
DrugBank: DB00675
PubChem:
ChEMBL:
InChI Key: NKANXQFJJICGDU-QPLCGJKRSA-N
SMILES: CCC(=C(c1ccccc1)c2ccc(cc2)OCCN(C)C)c3ccccc3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Stilbenes
- Subclass: None
- Class: Stilbenes
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | Q92731_CTX | Q92731 | antagonist | Ki(nM) = 0.51 IC50(nM) = 5.0 EC50(nM) = 1000.0 |
2 | Q15125_CTX | Q15125 | inhibitor | Ki(nM) = 5.0 IC50(nM) = 12.0 |
3 | A0L5S6_CTX | A0L5S6 | n/a | |
4 | P62508_CTX | P62508 | n/a | IC50(nM) = 62.0 |
5 | P04278_CTX | P04278 | inducer | |
6 | P45983_CTX | P45983 | modulator | |
7 | Q12809_CTX | Q12809 | inhibitor | IC50(nM) = 1584.89 |
8 | P03372_CTX | P03372 | antagonist | Ki(nM) = 12.0 IC50(nM) = 1.5 EC50(nM) = 622.0 |
9 | P10275_CTX | P10275 | n/a | |
10 | O75469_CTX | O75469 | n/a | |
11 | P23141_CTX | P23141 | n/a |