PDB ligand accession: CTZ
DrugBank: DB02194
PubChem:
ChEMBL: n/a
InChI Key: ULLMMKZQNNBLRN-SANMLTNESA-N
SMILES: c1ccc(cc1)CC2=NC(=CN3C2=NC(C3=O)(Cc4ccc(cc4)O)O)c5ccc(cc5)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | C9V488_CTZ | C9V488 | Ca2+-triggered coelenterazine-binding protein | n/a | |
| 2 | Q27709_CTZ | Q27709 | Obelin (OBL) | n/a |