PDB ligand accession: D0Q
DrugBank: n/a
PubChem: 150990;6950483;
ChEMBL: n/a
InChI Key: HUNCSWANZMJLPM-JTQLQIEISA-N
SMILES: Cc1ccc2c(c1)c(c[nH]2)CC(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P0A881_D0Q | P0A881 | n/a | |
2 | Q9S3V1_D0Q | Q9S3V1 | n/a | |
3 | D6RT90_D0Q | D6RT90 | n/a |