PDB ligand accession: DIF
DrugBank: DB00586
PubChem:
ChEMBL:
InChI Key: DCOPUUMXTXDBNB-UHFFFAOYSA-N
SMILES: c1ccc(c(c1)CC(=O)O)Nc2c(cccc2Cl)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Halobenzenes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q825I8_DIF | Q825I8 | Pentalenic acid synthase | n/a | |
2 | P14639_DIF | P14639 | Albumin | n/a | |
3 | Q8N4Q0_DIF | Q8N4Q0 | Prostaglandin reductase 3 | n/a | |
4 | F7BAY6_DIF | F7BAY6 | Albumin | n/a | |
5 | P02766_DIF | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | IC50(nM) = 3742.0 Kd(nM) = 60.0 |
6 | P35354_DIF | P35354 | Prostaglandin G/H synthase | inhibitor | IC50(nM) = 5.0 |
7 | G1U9S2_DIF | G1U9S2 | Albumin | n/a | |
8 | P05979_DIF | P05979 | Prostaglandin G/H synthase | n/a | IC50(nM) = 67.0 |
9 | P23219_DIF | P23219 | Prostaglandin G/H synthase | inhibitor | IC50(nM) = 3.0 |
10 | P37231_DIF | P37231 | Peroxisome proliferator-activated receptor | n/a | |
11 | P02768_DIF | P02768 | Albumin | n/a | Ki(nM) = 331000.0 Kd(nM) = 2455.0 |
12 | B3VHM9_DIF | B3VHM9 | Albumin | n/a | |
13 | Q05769_DIF | Q05769 | Prostaglandin G/H synthase | n/a | IC50(nM) = 22.0 |
14 | P00179_DIF | P00179 | Cytochrome P450 2C5 | n/a | |
15 | P24627_DIF | P24627 | Lactotransferrin (Lactoferrin) (EC | n/a | |
16 | P59071_DIF | P59071 | Basic phospholipase A2 | n/a | |
17 | Q95460_DIF | Q95460 | Major histocompatibility complex | n/a |